| Name | (2-fluorophenyl)(piperidin-4-yl)methanone hydrochloride |
| Synonyms | LogP Iloperidone Impurity 9(HCl) 4-(2-Fluorobenzoyl)piperidine HCl 4-(2-FLUOROBENZOYL)PIPERIDINE HYDROCHLORIDE (2-Fluorophenyl)-4-piperidinyl-Methanone HCl (2-Fluorophenyl)(4-piperidinyl)methanone hydrochloride (2-fluorophenyl)(piperidin-4-yl)methanone hydrochloride |
| CAS | 64671-29-0 |
| InChI | InChI=1/C12H14FNO.ClH/c13-11-4-2-1-3-10(11)12(15)9-5-7-14-8-6-9;/h1-4,9,14H,5-8H2;1H |
| Molecular Formula | C12H15ClFNO |
| Molar Mass | 243.71 |
| Melting Point | 185-187 °C(Solv: ethanol (64-17-5); ethyl ether (60-29-7)) |
| Boling Point | 344.9°C at 760 mmHg |
| Flash Point | 162.4°C |
| Vapor Presure | 4.53E-05mmHg at 25°C |
| Storage Condition | Room Temprature |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |